CAS 1245643-78-0
:4-(Cyclopropylmethoxy)-2-pyrimidinemethanol
Description:
4-(Cyclopropylmethoxy)-2-pyrimidinemethanol is a chemical compound characterized by its pyrimidine core, which is a six-membered aromatic ring containing two nitrogen atoms at positions 2 and 4. The presence of a cyclopropylmethoxy group contributes to its unique structural properties, potentially influencing its solubility and reactivity. This compound may exhibit specific biological activities due to its structural features, making it of interest in medicinal chemistry. The hydroxymethyl group at the 2-position of the pyrimidine ring suggests potential for hydrogen bonding, which can enhance interactions with biological targets. Additionally, the cyclopropyl moiety may impart distinct steric and electronic properties, affecting the compound's pharmacokinetics and pharmacodynamics. Overall, 4-(Cyclopropylmethoxy)-2-pyrimidinemethanol represents a class of compounds that could be explored for various applications, particularly in drug development, although specific biological data and applications would require further investigation.
Formula:C9H12N2O2
InChI:InChI=1S/C9H12N2O2/c12-5-8-10-4-3-9(11-8)13-6-7-1-2-7/h3-4,7,12H,1-2,5-6H2
InChI key:InChIKey=SPHKGQKZSFMOLD-UHFFFAOYSA-N
SMILES:O(CC1CC1)C2=NC(CO)=NC=C2
Synonyms:- [4-(Cyclopropylmethoxy)pyrimidin-2-yl]methanol
- 4-(Cyclopropylmethoxy)-2-pyrimidinemethanol
- 2-Pyrimidinemethanol, 4-(cyclopropylmethoxy)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
