CAS 1245643-84-8
:2-(6-Fluoro-2-pyridinyl)quinoline
Description:
2-(6-Fluoro-2-pyridinyl)quinoline is a chemical compound characterized by its unique structure, which combines a quinoline moiety with a pyridine ring substituted at the 6-position by a fluorine atom. This compound typically exhibits properties such as moderate to high lipophilicity due to its aromatic rings, which can influence its solubility and permeability in biological systems. The presence of the fluorine atom may enhance its metabolic stability and alter its electronic properties, potentially affecting its reactivity and interaction with biological targets. As a heterocyclic compound, it may exhibit interesting pharmacological activities, making it a subject of interest in medicinal chemistry. Its molecular structure allows for various potential applications, including in drug development, where it may serve as a lead compound or a scaffold for further modifications. Additionally, the compound's characteristics can be influenced by factors such as pH, solvent, and temperature, which are essential considerations in both laboratory and industrial settings.
Formula:C14H9FN2
InChI:InChI=1S/C14H9FN2/c15-14-7-3-6-12(17-14)13-9-8-10-4-1-2-5-11(10)16-13/h1-9H
InChI key:InChIKey=KWVMLWIOPYKHLC-UHFFFAOYSA-N
SMILES:FC1=NC(C2=NC3=C(C=C2)C=CC=C3)=CC=C1
Synonyms:- Quinoline, 2-(6-fluoro-2-pyridinyl)-
- 2-(6-Fluoro-2-pyridinyl)quinoline
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
