CAS 1245644-42-1

6-Bromo-3-iodoimidazo[1,2-a]pyrazine

Description:

6-Bromo-3-iodoimidazo[1,2-a]pyrazine is a heterocyclic compound characterized by its imidazo[1,2-a]pyrazine core, which incorporates both bromine and iodine substituents. This compound features a fused bicyclic structure that includes nitrogen atoms, contributing to its potential biological activity and reactivity. The presence of halogens, specifically bromine and iodine, can enhance the compound's lipophilicity and influence its interaction with biological targets, making it of interest in medicinal chemistry. Its molecular structure suggests potential applications in drug development, particularly in the fields of oncology and infectious diseases, where halogenated compounds often exhibit unique pharmacological properties. Additionally, the compound's stability, solubility, and reactivity can be influenced by the electronic effects of the halogen substituents, which may affect its synthesis and application in various chemical reactions. Overall, 6-Bromo-3-iodoimidazo[1,2-a]pyrazine represents a valuable scaffold for further exploration in chemical and pharmaceutical research.

Formula: C₆H₃BrIN<>sub>3

InChI: InChI=1S/C6H3BrIN3/c7-4-3-11-5(8)1-10-6(11)2-9-4/h1-3H

SMILES: c1c(I)n2cc(Br)ncc2n1

Imidazo[1,2-a]pyrazine, 6-bromo-3-iodo-

CAS: 1245644-42-1

Formula: C₆H₃BrIN₃

Purity: 98%

Color and Shape: Solid

Molecular weight: 323.9166

Ref: IN-DA000M8R

6-Bromo-3-iodo-imidazo[1,2-a]pyrazine

CAS: 1245644-42-1

6-Bromo-3-iodo-imidazo[1,2-a]pyrazine

Purity: 98%

Molecular weight: 323.92g/mol

Ref: 54-OR90102

6-Bromo-3-iodoimidazo[1,2-a]pyrazine

CAS: 1245644-42-1

Formula: C₆H₃BrIN₃

Purity: 98%

Color and Shape: Solid

Molecular weight: 323.919

Ref: 10-F078465