CAS 1245644-83-0
:4-(Cyclopropylmethoxy)pyrimidine
Description:
4-(Cyclopropylmethoxy)pyrimidine is a chemical compound characterized by its pyrimidine ring, which is a six-membered aromatic heterocycle containing two nitrogen atoms at positions 1 and 3. The presence of a cyclopropylmethoxy group at the 4-position of the pyrimidine ring contributes to its unique properties, potentially influencing its reactivity and biological activity. This compound may exhibit moderate to high lipophilicity due to the cyclopropyl group, which can enhance its ability to penetrate biological membranes. Additionally, the methoxy group can participate in hydrogen bonding, affecting solubility and interaction with other molecules. The compound's structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals targeting specific biological pathways. Its specific interactions and stability would depend on various factors, including pH, temperature, and the presence of other chemical species. Overall, 4-(Cyclopropylmethoxy)pyrimidine represents a versatile scaffold for further chemical modifications and investigations in drug discovery.
Formula:C8H10N2O
InChI:InChI=1S/C8H10N2O/c1-2-7(1)5-11-8-3-4-9-6-10-8/h3-4,6-7H,1-2,5H2
InChI key:InChIKey=IOWCCCQBRKLVJI-UHFFFAOYSA-N
SMILES:O(CC1CC1)C=2C=CN=CN2
Synonyms:- 4-(Cyclopropylmethoxy)pyrimidine
- Pyrimidine, 4-(cyclopropylmethoxy)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
