
CAS 1245645-33-3
:6-Amino-5-(diethoxymethyl)-4(3H)-pyrimidinone
Description:
6-Amino-5-(diethoxymethyl)-4(3H)-pyrimidinone is a pyrimidine derivative characterized by the presence of an amino group and a diethoxymethyl substituent. This compound features a pyrimidinone core, which is a six-membered aromatic ring containing nitrogen atoms, contributing to its potential biological activity. The diethoxymethyl group enhances its solubility and may influence its reactivity and interaction with biological targets. Typically, compounds of this nature are studied for their pharmacological properties, including potential antiviral or anticancer activities. The presence of the amino group can also facilitate hydrogen bonding, which is crucial for interactions with biomolecules. Additionally, the molecular structure suggests that it may participate in various chemical reactions, such as nucleophilic substitutions or condensation reactions, making it a versatile compound in synthetic organic chemistry. As with many pyrimidine derivatives, its stability, reactivity, and biological activity can be influenced by environmental factors such as pH and temperature.
Formula:C9H15N3O3
InChI:InChI=1S/C9H15N3O3/c1-3-14-9(15-4-2)6-7(10)11-5-12-8(6)13/h5,9H,3-4H2,1-2H3,(H3,10,11,12,13)
InChI key:InChIKey=IDOJADLIZFSVCX-UHFFFAOYSA-N
SMILES:C(OCC)(OCC)C1=C(N)NC=NC1=O
Synonyms:- 6-Amino-5-(diethoxymethyl)-4(3H)-pyrimidinone
- 4(3H)-Pyrimidinone, 6-amino-5-(diethoxymethyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
