
CAS 1245645-95-7
:1-[4-(6-Fluoro-2-pyridinyl)phenyl]ethanone
Description:
1-[4-(6-Fluoro-2-pyridinyl)phenyl]ethanone, with the CAS number 1245645-95-7, is an organic compound characterized by its ketone functional group and a complex aromatic structure. This compound features a phenyl ring substituted with a pyridine moiety that contains a fluorine atom, contributing to its unique chemical properties. The presence of the fluorine atom can enhance the compound's lipophilicity and influence its biological activity, making it of interest in medicinal chemistry. The ethanone group indicates that it is a ketone, which typically exhibits reactivity patterns such as nucleophilic addition and condensation reactions. The compound's molecular structure suggests potential applications in pharmaceuticals, particularly in the development of new therapeutic agents. Additionally, its stability and solubility characteristics can be influenced by the substituents on the aromatic rings, which may affect its interactions in biological systems. Overall, this compound represents a class of organic molecules that are significant in various chemical and biological research fields.
Formula:C13H10FNO
InChI:InChI=1S/C13H10FNO/c1-9(16)10-5-7-11(8-6-10)12-3-2-4-13(14)15-12/h2-8H,1H3
InChI key:InChIKey=AILJQQLSUSDXQU-UHFFFAOYSA-N
SMILES:FC1=NC(C2=CC=C(C(C)=O)C=C2)=CC=C1
Synonyms:- Ethanone, 1-[4-(6-fluoro-2-pyridinyl)phenyl]-
- 1-[4-(6-Fluoropyridin-2-yl)phenyl]ethan-1-one
- 1-[4-(6-Fluoro-2-pyridinyl)phenyl]ethanone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
