CymitQuimica logo

CAS 1245646-00-7

:

2′-Methoxy-N-methyl[4,4′-bipyridin]-2-amine

Description:
2′-Methoxy-N-methyl[4,4′-bipyridin]-2-amine is a chemical compound characterized by its bipyridine structure, which consists of two pyridine rings connected by a carbon-carbon bond. The presence of a methoxy group (-OCH₃) at the 2' position and a methylamino group (-N(CH₃)₂) at the 2 position of the bipyridine framework contributes to its unique chemical properties. This compound is likely to exhibit basicity due to the nitrogen atoms in the pyridine rings, which can participate in protonation reactions. Additionally, the methoxy group can influence the compound's solubility and reactivity, potentially enhancing its lipophilicity. The compound may also display interesting interactions with biological systems, making it a candidate for various applications in medicinal chemistry or materials science. Its specific reactivity and stability would depend on the surrounding conditions, such as pH and solvent polarity. Overall, 2′-Methoxy-N-methyl[4,4′-bipyridin]-2-amine represents a versatile structure with potential utility in various chemical and pharmaceutical contexts.
Formula:C12H13N3O
InChI:InChI=1S/C12H13N3O/c1-13-11-7-9(3-5-14-11)10-4-6-15-12(8-10)16-2/h3-8H,1-2H3,(H,13,14)
InChI key:InChIKey=SFRYBDGYFFCCCM-UHFFFAOYSA-N
SMILES:N(C)C1=CC(=CC=N1)C=2C=C(OC)N=CC2
Synonyms:
  • 2′-Methoxy-N-methyl[4,4′-bipyridin]-2-amine
  • [4,4′-Bipyridin]-2-amine, 2′-methoxy-N-methyl-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.