CAS 1245646-24-5
:1,1-Dimethylethyl 2-aminobenzenepropanoate
Description:
1,1-Dimethylethyl 2-aminobenzenepropanoate, identified by its CAS number 1245646-24-5, is an organic compound that features a complex structure incorporating both an amine and an ester functional group. This substance is characterized by its branched alkyl group, which contributes to its steric hindrance, potentially influencing its reactivity and interactions with other molecules. The presence of the amino group suggests that it may participate in hydrogen bonding, affecting its solubility and boiling point. Additionally, the aromatic ring in the structure can provide stability and influence the compound's electronic properties. Such compounds are often of interest in medicinal chemistry and materials science due to their potential biological activity and utility in synthesizing more complex molecules. The specific characteristics, such as melting point, boiling point, and solubility, would depend on the molecular interactions and the environment in which the compound is studied. Overall, 1,1-Dimethylethyl 2-aminobenzenepropanoate represents a versatile structure with potential applications in various chemical fields.
Formula:C13H19NO2
InChI:InChI=1S/C13H19NO2/c1-13(2,3)16-12(15)9-8-10-6-4-5-7-11(10)14/h4-7H,8-9,14H2,1-3H3
InChI key:InChIKey=HGIJHLYXGQVVEL-UHFFFAOYSA-N
SMILES:C(CC(OC(C)(C)C)=O)C1=C(N)C=CC=C1
Synonyms:- Benzenepropanoic acid, 2-amino-, 1,1-dimethylethyl ester
- 1,1-Dimethylethyl 2-aminobenzenepropanoate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
