CAS 1245647-05-5
:2-(1-spiro[8-Azabicyclo[3.2.1]octane-3,2′-oxiran]-8-ylethyl)-4-pyridinecarbonitrile
Description:
2-(1-spiro[8-Azabicyclo[3.2.1]octane-3,2′-oxiran]-8-ylethyl)-4-pyridinecarbonitrile is a complex organic compound characterized by its unique bicyclic structure and functional groups. The presence of a spirocyclic system contributes to its rigidity and potential for specific interactions with biological targets. The compound features a pyridine ring, which is known for its aromatic properties and ability to participate in various chemical reactions, including coordination with metal ions. The carbonitrile group enhances its reactivity and can influence its solubility and polarity. Additionally, the oxirane (epoxide) moiety introduces strain and reactivity, making it a potential site for nucleophilic attack. This compound may exhibit interesting pharmacological properties due to its structural features, making it a candidate for further research in medicinal chemistry. Its synthesis and characterization would typically involve advanced organic synthesis techniques, and its applications could range from drug development to materials science, depending on its specific interactions and properties.
Formula:C16H19N3O
InChI:InChI=1S/C16H19N3O/c1-11(15-6-12(9-17)4-5-18-15)19-13-2-3-14(19)8-16(7-13)10-20-16/h4-6,11,13-14H,2-3,7-8,10H2,1H3
InChI key:InChIKey=UBTNTJLBYCJOJF-UHFFFAOYSA-N
SMILES:C(C)(N1C2CC3(CC1CC2)CO3)C4=CC(C#N)=CC=N4
Synonyms:- 2-(1-spiro[8-Azabicyclo[3.2.1]octane-3,2′-oxiran]-8-ylethyl)-4-pyridinecarbonitrile
- 4-Pyridinecarbonitrile, 2-(1-spiro[8-azabicyclo[3.2.1]octane-3,2′-oxiran]-8-ylethyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.