CAS 1245648-01-4: 3-(3-Fluorophenyl)-3-pyrrolidinol

Description:3-(3-Fluorophenyl)-3-pyrrolidinol is a chemical compound characterized by its unique structure, which includes a pyrrolidine ring and a fluorophenyl group. The presence of the fluorine atom on the phenyl ring can influence the compound's electronic properties, potentially enhancing its lipophilicity and altering its reactivity compared to non-fluorinated analogs. This compound may exhibit interesting pharmacological properties, making it a subject of interest in medicinal chemistry. Its molecular structure suggests potential interactions with biological targets, which could be explored for therapeutic applications. Additionally, the compound's solubility, stability, and reactivity can be influenced by the functional groups present, making it important to consider these factors in any practical applications or synthesis. As with many organic compounds, safety and handling precautions should be observed, particularly due to the presence of the fluorine atom, which can impart unique toxicological properties. Overall, 3-(3-Fluorophenyl)-3-pyrrolidinol represents a valuable compound for further research in various chemical and biological contexts.

Formula:C₁₀H₁₂FNO

InChI:InChI=1S/C10H12FNO/c11-9-3-1-2-8(6-9)10(13)4-5-12-7-10/h1-3,6,12-13H,4-5,7H2

InChI key:InChIKey=REQRIBDNGWXWFI-UHFFFAOYSA-N

SMILES:FC1=CC=CC(=C1)C2(O)CNCC2

Synonyms:
3-(3-Fluorophenyl)-3-pyrrolidinol
3-Pyrrolidinol, 3-(3-fluorophenyl)-

Found 2 products.

Brand	Product data	Purity	Price range	Estimated delivery
	3-(3-Fluorophenyl)pyrrolidin-3-ol REF: 10-F746872CAS: 1245648-01-4	98%	- - -	Discontinued product
	3-(3-Fluorophenyl)pyrrolidin-3-ol REF: 3D-VZB64801CAS: 1245648-01-4	Min. 95%	- - -	Discontinued product