
CAS 1245648-10-5
:N-[(1R)-4-Hydroxy-1-(hydroxymethyl)butyl]benzamide
Description:
N-[(1R)-4-Hydroxy-1-(hydroxymethyl)butyl]benzamide is a chemical compound characterized by its specific structural features, including a benzamide moiety and a chiral hydroxymethylbutyl group. The presence of the hydroxyl groups contributes to its potential solubility in polar solvents and may influence its reactivity and interaction with biological systems. This compound is likely to exhibit hydrogen bonding capabilities due to the hydroxyl groups, which can affect its physical properties such as melting point and boiling point. Additionally, the chiral center in the butyl group suggests that the compound may exhibit stereoisomerism, which can be significant in pharmacological contexts, as different enantiomers may have different biological activities. The compound's molecular structure indicates potential applications in medicinal chemistry, particularly in the development of pharmaceuticals or as a biochemical probe. Its specific interactions and stability would depend on environmental conditions such as pH and temperature, which are critical for understanding its behavior in various applications.
Formula:C12H17NO3
InChI:InChI=1S/C12H17NO3/c14-8-4-7-11(9-15)13-12(16)10-5-2-1-3-6-10/h1-3,5-6,11,14-15H,4,7-9H2,(H,13,16)/t11-/m1/s1
InChI key:InChIKey=PSGWJXIMZBGAFZ-LLVKDONJSA-N
SMILES:C(N[C@H](CCCO)CO)(=O)C1=CC=CC=C1
Synonyms:- Benzamide, N-[(1R)-4-hydroxy-1-(hydroxymethyl)butyl]-
- N-[(1R)-4-Hydroxy-1-(hydroxymethyl)butyl]benzamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
