
CAS 1245648-37-6
:5-Bromo-2-(phenylmethoxy)-3-pyridinamine
Description:
5-Bromo-2-(phenylmethoxy)-3-pyridinamine is a chemical compound characterized by its unique structure, which includes a pyridine ring substituted with a bromine atom and a phenylmethoxy group. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, such as potential solubility in organic solvents and moderate stability under standard conditions. The presence of the bromine atom may impart specific reactivity, making it useful in various synthetic applications, including medicinal chemistry and material science. The phenylmethoxy group can enhance lipophilicity, potentially influencing the compound's biological activity and interaction with biological targets. Additionally, the amine functional group may participate in hydrogen bonding, affecting the compound's solubility and reactivity. Overall, 5-Bromo-2-(phenylmethoxy)-3-pyridinamine is of interest in research contexts, particularly in the development of pharmaceuticals or agrochemicals, where its structural features can be leveraged for specific applications.
Formula:C12H11BrN2O
InChI:InChI=1S/C12H11BrN2O/c13-10-6-11(14)12(15-7-10)16-8-9-4-2-1-3-5-9/h1-7H,8,14H2
InChI key:InChIKey=JFPLHVNJHOJVPF-UHFFFAOYSA-N
SMILES:O(CC1=CC=CC=C1)C2=C(N)C=C(Br)C=N2
Synonyms:- 5-Bromo-2-(phenylmethoxy)-3-pyridinamine
- 3-Pyridinamine, 5-bromo-2-(phenylmethoxy)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
