CAS 1245648-41-2
:2-Fluoro-6-(4-nitrophenyl)pyridine
Description:
2-Fluoro-6-(4-nitrophenyl)pyridine is an organic compound characterized by its pyridine ring, which is substituted at the 2-position with a fluorine atom and at the 6-position with a 4-nitrophenyl group. This compound features a heterocyclic structure, where the nitrogen atom in the pyridine contributes to its basicity and potential reactivity. The presence of the nitro group (-NO2) on the phenyl ring enhances the compound's electrophilic character, making it useful in various chemical reactions, including nucleophilic substitutions. The fluorine atom can influence the compound's electronic properties and steric effects, potentially affecting its solubility and reactivity. 2-Fluoro-6-(4-nitrophenyl)pyridine may find applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to its unique structural features that can interact with biological targets. Additionally, its properties can be explored in materials science and organic synthesis, where the functional groups can be leveraged for further chemical transformations.
Formula:C11H7FN2O2
InChI:InChI=1S/C11H7FN2O2/c12-11-3-1-2-10(13-11)8-4-6-9(7-5-8)14(15)16/h1-7H
InChI key:InChIKey=PPFPFLVMKSRITF-UHFFFAOYSA-N
SMILES:FC1=NC(C2=CC=C(N(=O)=O)C=C2)=CC=C1
Synonyms:- Pyridine, 2-fluoro-6-(4-nitrophenyl)-
- 2-Fluoro-6-(4-nitrophenyl)pyridine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
