
CAS 1245648-61-6
:Furo[3,2-c]pyridin-7-ol, hydrochloride (1:1)
Description:
Furo[3,2-c]pyridin-7-ol, hydrochloride (1:1) is a chemical compound characterized by its unique bicyclic structure, which incorporates both furan and pyridine rings. This compound typically appears as a white to off-white crystalline solid and is soluble in water due to the presence of the hydrochloride salt form, which enhances its solubility and stability. The presence of the hydroxyl group (-OH) at the 7-position of the pyridine ring contributes to its potential reactivity and biological activity. Furo[3,2-c]pyridin-7-ol derivatives have been studied for their pharmacological properties, including potential applications in medicinal chemistry. The hydrochloride form indicates that the compound is in a salt form, which is often used to improve the compound's handling and bioavailability. As with many organic compounds, proper safety measures should be taken when handling this substance, including the use of personal protective equipment and adherence to safety data sheet guidelines.
Formula:C7H5NO2·ClH
InChI:InChI=1S/C7H5NO2.ClH/c9-6-4-8-3-5-1-2-10-7(5)6;/h1-4,9H;1H
InChI key:InChIKey=LSIIQIKBRMBIGT-UHFFFAOYSA-N
SMILES:OC1=C2C(=CN=C1)C=CO2.Cl
Synonyms:- Furo[3,2-c]pyridin-7-ol, hydrochloride (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.