CymitQuimica logo

CAS 1245649-28-8

:

Pyrrolidine, 2-(3,5-dimethylphenyl)-, hydrochloride (1:1), (2S)-

Description:
Pyrrolidine, 2-(3,5-dimethylphenyl)-, hydrochloride (1:1), (2S)- is a chemical compound characterized by its pyrrolidine ring structure, which is a five-membered saturated heterocycle containing one nitrogen atom. The compound features a 3,5-dimethylphenyl substituent, indicating the presence of a phenyl group with two methyl groups at the 3 and 5 positions, contributing to its hydrophobic characteristics. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its bioavailability for pharmaceutical applications. The (2S)- designation indicates that the compound has a specific stereochemistry, which can influence its biological activity and interaction with receptors. This compound may be of interest in medicinal chemistry, particularly in the development of drugs targeting the central nervous system or other therapeutic areas. Its properties, such as melting point, solubility, and stability, would be influenced by the presence of the hydrochloride group and the specific arrangement of its substituents.
Formula:C12H17N·ClH
InChI:InChI=1S/C12H17N.ClH/c1-9-6-10(2)8-11(7-9)12-4-3-5-13-12;/h6-8,12-13H,3-5H2,1-2H3;1H/t12-;/m0./s1
InChI key:InChIKey=QPEZQRMAVIUWJM-YDALLXLXSA-N
SMILES:CC=1C=C(C=C(C)C1)[C@@H]2CCCN2.Cl
Synonyms:
  • Pyrrolidine, 2-(3,5-dimethylphenyl)-, hydrochloride (1:1), (2S)-
Found 3 products.