CAS 1245649-55-1

1-Ethenylcyclobutaneacetic acid

Description:

1-Ethenylcyclobutaneacetic acid, identified by its CAS number 1245649-55-1, is an organic compound characterized by a cyclobutane ring with an ethenyl group and an acetic acid functional group. This compound features a unique structure that combines cyclic and aliphatic elements, which can influence its reactivity and physical properties. Typically, compounds of this nature may exhibit moderate polarity due to the presence of the carboxylic acid group, which can engage in hydrogen bonding. The ethenyl group introduces unsaturation, potentially allowing for further chemical reactivity, such as polymerization or addition reactions. In terms of applications, compounds with similar structures are often explored in organic synthesis, materials science, and as intermediates in the production of more complex molecules. However, specific data regarding its stability, solubility, and biological activity would require empirical studies or literature references for comprehensive understanding. Overall, 1-ethenylcyclobutaneacetic acid represents a fascinating area of study within organic chemistry due to its structural features and potential applications.

Formula: C₈H₁₂O₂

InChI: InChI=1S/C8H12O2/c1-2-8(4-3-5-8)6-7(9)10/h2H,1,3-6H2,(H,9,10)

InChI key: InChIKey=WYXFZXIHQCPNJL-UHFFFAOYSA-N

SMILES: C(C(O)=O)C1(C=C)CCC1

Synonyms:

• 1-Ethenylcyclobutaneacetic acid
• Cyclobutaneacetic acid, 1-ethenyl-