CymitQuimica logo

CAS 1245649-65-3

:

4,5-Dichloro-2-(tetrahydro-2H-pyran-3-yl)-3(2H)-pyridazinone

Description:
4,5-Dichloro-2-(tetrahydro-2H-pyran-3-yl)-3(2H)-pyridazinone is a chemical compound characterized by its unique structure, which includes a pyridazinone core substituted with dichloro and tetrahydropyran moieties. The presence of chlorine atoms at the 4 and 5 positions of the pyridazinone ring contributes to its reactivity and potential biological activity. The tetrahydropyran group enhances the compound's lipophilicity, which may influence its pharmacokinetic properties. This compound is of interest in medicinal chemistry due to its potential applications in drug development, particularly in targeting specific biological pathways. Its molecular structure suggests that it may exhibit various interactions with biological macromolecules, making it a candidate for further investigation in therapeutic contexts. Additionally, the compound's stability, solubility, and reactivity can be influenced by the functional groups present, which are critical for understanding its behavior in different environments. Overall, 4,5-Dichloro-2-(tetrahydro-2H-pyran-3-yl)-3(2H)-pyridazinone represents a complex chemical entity with potential implications in various fields, including pharmaceuticals and agrochemicals.
Formula:C9H10Cl2N2O2
InChI:InChI=1S/C9H10Cl2N2O2/c10-7-4-12-13(9(14)8(7)11)6-2-1-3-15-5-6/h4,6H,1-3,5H2
InChI key:InChIKey=OEIQXPVDMWBQKW-UHFFFAOYSA-N
SMILES:O=C1N(N=CC(Cl)=C1Cl)C2CCCOC2
Synonyms:
  • 4,5-Dichloro-2-(tetrahydro-2H-pyran-3-yl)-3(2H)-pyridazinone
  • 3(2H)-Pyridazinone, 4,5-dichloro-2-(tetrahydro-2H-pyran-3-yl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.