CymitQuimica logo

CAS 1245649-67-5

:

6-Fluoro-6′-(trifluoromethyl)-2,3′-bipyridine

Description:
6-Fluoro-6′-(trifluoromethyl)-2,3′-bipyridine is a chemical compound characterized by its bipyridine structure, which consists of two pyridine rings connected by a carbon-carbon bond. The presence of a fluorine atom at the 6-position of one pyridine ring and a trifluoromethyl group at the 6′-position of the other ring significantly influences its chemical properties, including its reactivity and polarity. This compound is typically a solid at room temperature and exhibits a relatively high thermal stability due to the strength of the carbon-fluorine bonds. Its unique functional groups make it a valuable intermediate in organic synthesis and a potential candidate for applications in pharmaceuticals and agrochemicals. Additionally, the trifluoromethyl group enhances lipophilicity, which can affect the compound's bioavailability and interaction with biological systems. Overall, 6-Fluoro-6′-(trifluoromethyl)-2,3′-bipyridine is notable for its distinctive structural features and potential utility in various chemical applications.
Formula:C11H6F4N2
InChI:InChI=1S/C11H6F4N2/c12-10-3-1-2-8(17-10)7-4-5-9(16-6-7)11(13,14)15/h1-6H
InChI key:InChIKey=WMJJJTNWGULSDY-UHFFFAOYSA-N
SMILES:FC1=NC(=CC=C1)C=2C=CC(C(F)(F)F)=NC2
Synonyms:
  • 2,3′-Bipyridine, 6-fluoro-6′-(trifluoromethyl)-
  • 6-Fluoro-6′-(trifluoromethyl)-2,3′-bipyridine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.