CAS 1245650-01-4
:2-Fluoro-6-(3-methylphenyl)pyridine
Description:
2-Fluoro-6-(3-methylphenyl)pyridine is an organic compound characterized by its pyridine ring, which is a six-membered aromatic heterocycle containing one nitrogen atom. The presence of a fluorine atom at the 2-position and a 3-methylphenyl group at the 6-position contributes to its unique chemical properties. This compound is likely to exhibit moderate polarity due to the electronegative fluorine substituent, which can influence its reactivity and solubility in various solvents. The methyl group on the phenyl ring can provide steric hindrance, potentially affecting its interactions with other molecules. Additionally, the compound may participate in various chemical reactions typical of aromatic compounds, such as electrophilic substitution. Its specific applications may vary, but compounds of this nature are often explored in medicinal chemistry and material science for their potential biological activity and utility in synthesizing more complex structures. Safety and handling precautions should be observed, as with all chemical substances, due to potential toxicity or reactivity.
Formula:C12H10FN
InChI:InChI=1S/C12H10FN/c1-9-4-2-5-10(8-9)11-6-3-7-12(13)14-11/h2-8H,1H3
InChI key:InChIKey=QYGLBCXPYNRJMK-UHFFFAOYSA-N
SMILES:CC=1C=C(C=CC1)C=2N=C(F)C=CC2
Synonyms:- 2-Fluoro-6-m-tolylpyridine
- 2-Fluoro-6-(3-methylphenyl)pyridine
- 2-Fluoro-6-(m-tolyl)pyridine
- Pyridine, 2-fluoro-6-(3-methylphenyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
