CAS 124570-61-2
:5-(4-Morpholinyl)pyrazolo[1,5-a]quinazoline-3-carbonitrile
Description:
5-(4-Morpholinyl)pyrazolo[1,5-a]quinazoline-3-carbonitrile is a chemical compound characterized by its unique structural features, which include a pyrazoloquinazoline core and a morpholine substituent. This compound typically exhibits a molecular formula that reflects its complex structure, incorporating elements such as carbon, hydrogen, nitrogen, and oxygen. It is known for its potential biological activity, particularly in the field of medicinal chemistry, where it may serve as a lead compound for the development of pharmaceuticals targeting various diseases. The presence of the cyano group (carbonitrile) enhances its reactivity and may contribute to its pharmacological properties. Additionally, the morpholine ring can influence the compound's solubility and interaction with biological targets. As with many heterocyclic compounds, its synthesis and characterization involve various organic chemistry techniques, and it may be evaluated for its efficacy and safety in preclinical studies. Overall, this compound represents a significant interest in drug discovery and development due to its structural diversity and potential therapeutic applications.
Formula:C15H13N5O
InChI:InChI=1S/C15H13N5O/c16-9-11-10-17-20-13-4-2-1-3-12(13)15(18-14(11)20)19-5-7-21-8-6-19/h1-4,10H,5-8H2
InChI key:InChIKey=SWMVEKOZWMIKFL-UHFFFAOYSA-N
SMILES:C(#N)C1=C2N(C=3C(C(=N2)N4CCOCC4)=CC=CC3)N=C1
Synonyms:- Pyrazolo[1,5-a]quinazoline-3-carbonitrile, 5-(4-morpholinyl)-
- 5-(4-Morpholinyl)pyrazolo[1,5-a]quinazoline-3-carbonitrile
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.