
CAS 1245771-47-4
:N-[(5-Fluoro-2-thienyl)methyl]-2-furanethanamine
Description:
N-[(5-Fluoro-2-thienyl)methyl]-2-furanethanamine is a chemical compound characterized by its unique structure, which includes a furan ring and a thienyl group substituted with a fluorine atom. This compound is classified as an amine due to the presence of the ethanamine functional group. The fluorine substitution on the thienyl ring can influence the compound's reactivity and biological activity, potentially enhancing its lipophilicity and altering its pharmacokinetic properties. The presence of both the furan and thienyl moieties suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals targeting various biological pathways. Additionally, the compound's molecular interactions may be influenced by the electron-withdrawing nature of the fluorine atom, which can affect its binding affinity to biological targets. Overall, N-[(5-Fluoro-2-thienyl)methyl]-2-furanethanamine represents a compound of interest for further research in drug development and chemical synthesis.
Formula:C11H12FNOS
InChI:InChI=1S/C11H12FNOS/c12-11-4-3-10(15-11)8-13-6-5-9-2-1-7-14-9/h1-4,7,13H,5-6,8H2
InChI key:InChIKey=OWNWJEZAKAEYME-UHFFFAOYSA-N
SMILES:C(NCCC1=CC=CO1)C=2SC(F)=CC2
Synonyms:- N-[(5-Fluoro-2-thienyl)methyl]-2-furanethanamine
- 2-Furanethanamine, N-[(5-fluoro-2-thienyl)methyl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.