
CAS 1245771-48-5
:Ethyl 1-[(5-fluoro-2-thienyl)methyl]-4-piperidinecarboxylate
Description:
Ethyl 1-[(5-fluoro-2-thienyl)methyl]-4-piperidinecarboxylate is a chemical compound characterized by its unique structure, which includes a piperidine ring, an ethyl ester group, and a thienyl moiety substituted with a fluorine atom. This compound is typically classified as an organic molecule and may exhibit properties such as moderate solubility in organic solvents due to the presence of both polar and non-polar functional groups. The fluorine atom can enhance the compound's lipophilicity and potentially influence its biological activity. The piperidine ring contributes to the compound's basicity and may participate in various chemical reactions, including nucleophilic substitutions. Ethyl 1-[(5-fluoro-2-thienyl)methyl]-4-piperidinecarboxylate may be of interest in medicinal chemistry, particularly in the development of pharmaceuticals, due to its structural features that could interact with biological targets. However, specific data regarding its reactivity, stability, and biological effects would require further investigation through experimental studies.
Formula:C13H18FNO2S
InChI:InChI=1S/C13H18FNO2S/c1-2-17-13(16)10-5-7-15(8-6-10)9-11-3-4-12(14)18-11/h3-4,10H,2,5-9H2,1H3
InChI key:InChIKey=VWHFPNALNWXKMW-UHFFFAOYSA-N
SMILES:C(OCC)(=O)C1CCN(CC=2SC(F)=CC2)CC1
Synonyms:- 4-Piperidinecarboxylic acid, 1-[(5-fluoro-2-thienyl)methyl]-, ethyl ester
- Ethyl 1-[(5-fluoro-2-thienyl)methyl]-4-piperidinecarboxylate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.