CymitQuimica logo

CAS 1245771-51-0

:

1-[(5-Fluoro-2-thienyl)methyl]-4-piperidinamine

Description:
1-[(5-Fluoro-2-thienyl)methyl]-4-piperidinamine is a chemical compound characterized by its unique structure, which includes a piperidine ring and a thienyl group substituted with a fluorine atom. The presence of the fluorine atom enhances the compound's lipophilicity and may influence its biological activity. This compound typically exhibits properties such as moderate solubility in organic solvents and potential reactivity due to the amine functional group. It may also participate in hydrogen bonding due to the amine, which can affect its interaction with biological targets. The thienyl moiety contributes to its aromatic character, potentially impacting its electronic properties. Compounds like this are often studied for their pharmacological potential, particularly in the context of drug discovery, where modifications to the structure can lead to variations in activity and selectivity. As with many synthetic organic compounds, safety and handling precautions are essential due to potential toxicity or reactivity.
Formula:C10H15FN2S
InChI:InChI=1S/C10H15FN2S/c11-10-2-1-9(14-10)7-13-5-3-8(12)4-6-13/h1-2,8H,3-7,12H2
InChI key:InChIKey=VDNKBRFBUAPGEP-UHFFFAOYSA-N
SMILES:C(C=1SC(F)=CC1)N2CCC(N)CC2
Synonyms:
  • 4-Piperidinamine, 1-[(5-fluoro-2-thienyl)methyl]-
  • 1-[(5-Fluoro-2-thienyl)methyl]-4-piperidinamine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.