
CAS 1245771-62-3
:N,1-Diethyl-4-nitro-1H-pyrazole-5-carboxamide
Description:
N,1-Diethyl-4-nitro-1H-pyrazole-5-carboxamide is a chemical compound characterized by its pyrazole ring structure, which is a five-membered heterocyclic compound containing two nitrogen atoms. This substance features a diethyl group at the nitrogen position, contributing to its lipophilicity and potential biological activity. The presence of a nitro group at the 4-position of the pyrazole ring introduces significant electron-withdrawing characteristics, which can influence the compound's reactivity and stability. Additionally, the carboxamide functional group at the 5-position enhances its solubility in polar solvents and may play a role in hydrogen bonding interactions. This compound is of interest in various fields, including medicinal chemistry and agrochemicals, due to its potential applications in drug development and as a biochemical agent. Its specific properties, such as melting point, solubility, and biological activity, would require empirical investigation to fully characterize its behavior in different environments.
Formula:C8H12N4O3
InChI:InChI=1S/C8H12N4O3/c1-3-9-8(13)7-6(12(14)15)5-10-11(7)4-2/h5H,3-4H2,1-2H3,(H,9,13)
InChI key:InChIKey=UDDXRHIWSTXYPB-UHFFFAOYSA-N
SMILES:C(NCC)(=O)C1=C(N(=O)=O)C=NN1CC
Synonyms:- N,1-Diethyl-4-nitro-1H-pyrazole-5-carboxamide
- 1H-Pyrazole-5-carboxamide, N,1-diethyl-4-nitro-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.