CAS 1245771-73-6

1-Methyl-5-nitro-1H-pyrazole-3-carboxamide

Description:

1-Methyl-5-nitro-1H-pyrazole-3-carboxamide is a chemical compound characterized by its pyrazole ring structure, which is a five-membered aromatic ring containing two nitrogen atoms. The presence of a methyl group at the 1-position and a nitro group at the 5-position contributes to its unique reactivity and properties. The carboxamide functional group at the 3-position enhances its potential for hydrogen bonding, making it soluble in polar solvents. This compound may exhibit biological activity, which is often explored in pharmaceutical research, particularly in the development of agrochemicals or medicinal agents. Its molecular structure suggests potential applications in various fields, including biochemistry and material science. The CAS number 1245771-73-6 serves as a unique identifier for this substance, facilitating its identification in chemical databases and literature. Overall, 1-Methyl-5-nitro-1H-pyrazole-3-carboxamide is notable for its structural features and potential applications in scientific research.

Formula: C₅H₆N₄O₃

InChI: InChI=1S/C5H6N4O3/c1-8-4(9(11)12)2-3(7-8)5(6)10/h2H,1H3,(H2,6,10)

InChI key: InChIKey=HKNPTXQHZRXDAD-UHFFFAOYSA-N

SMILES: C(N)(=O)C=1C=C(N(=O)=O)N(C)N1

Synonyms:

• 1-Methyl-5-nitro-1H-pyrazole-3-carboxamide
• 1H-Pyrazole-3-carboxamide, 1-methyl-5-nitro-