CAS 1245772-02-4

Methyl 1-(2,2-difluoroethyl)-4-piperidineacetate

Description:

Methyl 1-(2,2-difluoroethyl)-4-piperidineacetate is a chemical compound characterized by its piperidine ring structure, which is a six-membered nitrogen-containing heterocycle. The presence of a difluoroethyl group introduces significant electronegativity, influencing the compound's reactivity and potential biological activity. The acetate functional group contributes to its solubility in organic solvents and may affect its pharmacokinetic properties. This compound is typically studied in the context of medicinal chemistry, where modifications to the piperidine structure can lead to variations in potency and selectivity for biological targets. Its unique fluorinated side chain may enhance lipophilicity and metabolic stability, making it a candidate for further research in drug development. As with many synthetic organic compounds, safety and handling precautions are essential due to potential toxicity or reactivity. Overall, Methyl 1-(2,2-difluoroethyl)-4-piperidineacetate represents a class of compounds that may have applications in pharmaceuticals or agrochemicals, warranting further investigation into its properties and effects.

Formula: C₁₀H₁₇F₂NO₂

InChI: InChI=1S/C10H17F2NO2/c1-15-10(14)6-8-2-4-13(5-3-8)7-9(11)12/h8-9H,2-7H2,1H3

InChI key: InChIKey=JCYZWIYMAQQOSD-UHFFFAOYSA-N

SMILES: C(C(OC)=O)C1CCN(CC(F)F)CC1

Synonyms:

• 4-Piperidineacetic acid, 1-(2,2-difluoroethyl)-, methyl ester
• Methyl 1-(2,2-difluoroethyl)-4-piperidineacetate