CAS 1245772-14-8

2-(Difluoromethoxy)-4-methyl-1-nitrobenzene

Description:

2-(Difluoromethoxy)-4-methyl-1-nitrobenzene is an organic compound characterized by its aromatic structure, which includes a nitro group (-NO2) and a difluoromethoxy group (-O-CHF2) attached to a methyl-substituted benzene ring. The presence of the nitro group contributes to its electron-withdrawing properties, influencing the compound's reactivity and polarity. The difluoromethoxy group enhances the compound's lipophilicity and may affect its solubility in various solvents. This compound is likely to exhibit moderate stability under standard conditions but may undergo reactions typical of nitro and ether functionalities, such as nucleophilic substitution or reduction. Its unique structure suggests potential applications in pharmaceuticals or agrochemicals, where such substituents can modulate biological activity. Safety and handling considerations are essential, as nitro compounds can be hazardous, and the presence of fluorine atoms may introduce additional toxicity concerns. Overall, 2-(Difluoromethoxy)-4-methyl-1-nitrobenzene represents a complex molecule with specific chemical properties that warrant careful study in both synthetic and applied chemistry contexts.

Formula: C₈H₇F₂NO₃

InChI: InChI=1S/C8H7F2NO3/c1-5-2-3-6(11(12)13)7(4-5)14-8(9)10/h2-4,8H,1H3

InChI key: InChIKey=ZHFMXJOSNWFUND-UHFFFAOYSA-N

SMILES: N(=O)(=O)C1=C(OC(F)F)C=C(C)C=C1

Synonyms:

• Benzene, 2-(difluoromethoxy)-4-methyl-1-nitro-
• 2-(Difluoromethoxy)-4-methyl-1-nitrobenzene

2-(Difluoromethoxy)-4-methyl-1-nitrobenzene

CAS: 1245772-14-8

Versatile small molecule scaffold

Formula: C₈H₇F₂NO₃

Purity: Min. 95%

Molecular weight: 203.14 g/mol

Ref: 3D-VZB77214