CymitQuimica logo

CAS 1245772-44-4

:

1-(Difluoromethyl)-1H-pyrazole-5-carboxamide

Description:
1-(Difluoromethyl)-1H-pyrazole-5-carboxamide is a chemical compound characterized by its pyrazole ring structure, which is a five-membered aromatic heterocycle containing two nitrogen atoms. The presence of a difluoromethyl group indicates that two fluorine atoms are attached to a carbon atom adjacent to the pyrazole ring, influencing the compound's reactivity and polarity. The carboxamide functional group contributes to its potential as a hydrogen bond donor and acceptor, enhancing its solubility in polar solvents and its interaction with biological targets. This compound may exhibit interesting pharmacological properties, making it a subject of interest in medicinal chemistry. Its unique combination of functional groups suggests potential applications in agrochemicals or pharmaceuticals, particularly in the development of new therapeutic agents. The molecular structure and substituents play a crucial role in determining its chemical behavior, stability, and biological activity. As with many compounds, safety and handling precautions should be observed due to potential toxicity or reactivity.
Formula:C5H5F2N3O
InChI:InChI=1S/C5H5F2N3O/c6-5(7)10-3(4(8)11)1-2-9-10/h1-2,5H,(H2,8,11)
InChI key:InChIKey=ZBZJKHFNIPASBU-UHFFFAOYSA-N
SMILES:C(N)(=O)C=1N(C(F)F)N=CC1
Synonyms:
  • 1H-Pyrazole-5-carboxamide, 1-(difluoromethyl)-
  • 1-(Difluoromethyl)-1H-pyrazole-5-carboxamide
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.