CAS 1245772-45-5

1-Ethyl-5-(trifluoromethyl)-1H-pyrazole-3-methanol

Description:

1-Ethyl-5-(trifluoromethyl)-1H-pyrazole-3-methanol is a chemical compound characterized by its unique pyrazole structure, which includes a trifluoromethyl group and an ethyl substituent. This compound features a hydroxymethyl group at the 3-position of the pyrazole ring, contributing to its potential reactivity and solubility in various solvents. The presence of the trifluoromethyl group enhances its lipophilicity and may influence its biological activity, making it of interest in pharmaceutical research. The compound is likely to exhibit moderate stability under standard conditions, but specific reactivity can depend on the surrounding environment and functional groups. Its molecular structure suggests potential applications in agrochemicals or medicinal chemistry, particularly in the development of novel compounds with specific biological activities. As with many pyrazole derivatives, it may also exhibit interesting properties such as anti-inflammatory or anti-cancer activities, warranting further investigation. Safety and handling precautions should be observed, as with all chemical substances, due to potential toxicity or reactivity.

Formula: C₇H₉F₃N₂O

InChI: InChI=1S/C7H9F3N2O/c1-2-12-6(7(8,9)10)3-5(4-13)11-12/h3,13H,2,4H2,1H3

InChI key: InChIKey=IUAHWSVKZMNQJA-UHFFFAOYSA-N

SMILES: C(F)(F)(F)C=1N(CC)N=C(CO)C1

Synonyms:

• 1-Ethyl-5-(trifluoromethyl)-1H-pyrazole-3-methanol
• [1-Ethyl-5-(trifluoromethyl)pyrazol-3-yl]methanol
• 1H-Pyrazole-3-methanol, 1-ethyl-5-(trifluoromethyl)-