CAS 1245772-67-1

1H-Pyrazole, 1-(difluoromethyl)-5-methyl-3-nitro-

Description:

1H-Pyrazole, 1-(difluoromethyl)-5-methyl-3-nitro- is a chemical compound characterized by its pyrazole ring structure, which consists of a five-membered ring containing two adjacent nitrogen atoms. This compound features a difluoromethyl group, which contributes to its unique reactivity and potential applications in various fields, including pharmaceuticals and agrochemicals. The presence of a methyl group and a nitro group on the pyrazole ring further influences its chemical properties, such as polarity and reactivity. The nitro group is known for its electron-withdrawing effects, which can enhance the compound's electrophilic character. Additionally, the difluoromethyl group can impart distinct physical properties, such as increased lipophilicity. The compound's molecular structure suggests potential applications in medicinal chemistry, particularly in the development of new therapeutic agents. As with many pyrazole derivatives, it may exhibit biological activity, making it of interest for further research and development. Safety and handling precautions should be observed due to the presence of the nitro group, which can pose hazards in certain conditions.

Formula: C₅H₅F₂N₃O₂

InChI: InChI=1S/C5H5F2N3O2/c1-3-2-4(10(11)12)8-9(3)5(6)7/h2,5H,1H3

InChI key: InChIKey=JXXNIUKGXITULT-UHFFFAOYSA-N

SMILES: N(=O)(=O)C1=NN(C(F)F)C(C)=C1

Synonyms:

• 1H-Pyrazole, 1-(difluoromethyl)-5-methyl-3-nitro-
• 1-(Difluoromethyl)-5-methyl-3-nitro-1H-pyrazole