CAS 1245772-89-7

1-(2-Thiazolylsulfonyl)piperazine

Description:

1-(2-Thiazolylsulfonyl)piperazine is a chemical compound characterized by its unique structural features, which include a piperazine ring and a thiazole moiety linked through a sulfonyl group. This compound typically exhibits properties associated with both heterocyclic and sulfonamide compounds, making it of interest in medicinal chemistry. The presence of the thiazole ring contributes to its potential biological activity, as thiazoles are often found in various pharmaceuticals and bioactive molecules. The sulfonyl group enhances the compound's solubility and reactivity, which can influence its pharmacokinetic properties. Additionally, 1-(2-Thiazolylsulfonyl)piperazine may exhibit specific interactions with biological targets, potentially leading to applications in drug development. Its molecular structure suggests it could participate in hydrogen bonding and other intermolecular interactions, which are crucial for its biological efficacy. Overall, this compound represents a class of substances that may have significant implications in therapeutic applications, particularly in areas such as antimicrobial or anticancer research.

Formula: C₇H₁₁N₃O₂S₂

InChI: InChI=1S/C7H11N3O2S2/c11-14(12,7-9-3-6-13-7)10-4-1-8-2-5-10/h3,6,8H,1-2,4-5H2

InChI key: InChIKey=LYDIQZZOHINMAL-UHFFFAOYSA-N

SMILES: S(=O)(=O)(C1=NC=CS1)N2CCNCC2

Synonyms:

• Piperazine, 1-(2-thiazolylsulfonyl)-
• 1-(2-Thiazolylsulfonyl)piperazine