
CAS 1245772-91-1
:3-Methyl-5-(trifluoromethyl)-1H-pyrazole-1-propanamine
Description:
3-Methyl-5-(trifluoromethyl)-1H-pyrazole-1-propanamine is a chemical compound characterized by its pyrazole ring structure, which is a five-membered aromatic ring containing two nitrogen atoms. The presence of a methyl group at the 3-position and a trifluoromethyl group at the 5-position contributes to its unique chemical properties, including increased lipophilicity and potential biological activity. The propanamine side chain enhances its reactivity and solubility in various solvents. This compound may exhibit interesting pharmacological properties, making it of interest in medicinal chemistry and drug development. Its trifluoromethyl group is known to influence the electronic properties of the molecule, potentially affecting its interaction with biological targets. As with many pyrazole derivatives, it may be investigated for applications in agrochemicals or pharmaceuticals. Safety and handling precautions should be observed, as with all chemical substances, due to potential toxicity or reactivity. Further studies would be necessary to fully elucidate its properties and potential applications.
Formula:C8H12F3N3
InChI:InChI=1S/C8H12F3N3/c1-6-5-7(8(9,10)11)14(13-6)4-2-3-12/h5H,2-4,12H2,1H3
InChI key:InChIKey=QBXXUVMGSAVQGZ-UHFFFAOYSA-N
SMILES:C(F)(F)(F)C=1N(CCCN)N=C(C)C1
Synonyms:- 1H-Pyrazole-1-propanamine, 3-methyl-5-(trifluoromethyl)-
- 3-Methyl-5-(trifluoromethyl)-1H-pyrazole-1-propanamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.