CymitQuimica logo

CAS 1245773-02-7

:

2-(Difluoromethoxy)-1-methoxy-3-nitrobenzene

Description:
2-(Difluoromethoxy)-1-methoxy-3-nitrobenzene is an organic compound characterized by its complex structure, which includes a benzene ring substituted with multiple functional groups. The presence of both difluoromethoxy and methoxy groups indicates that the compound has significant electronegative elements, which can influence its reactivity and polarity. The nitro group, known for its electron-withdrawing properties, contributes to the compound's overall chemical behavior, potentially enhancing its reactivity in electrophilic aromatic substitution reactions. This compound may exhibit properties such as moderate solubility in organic solvents, and its fluorine atoms can impart unique characteristics, such as increased lipophilicity and altered electronic properties. The presence of multiple substituents can also affect the compound's stability and interaction with biological systems, making it of interest in medicinal chemistry and material science. Overall, 2-(Difluoromethoxy)-1-methoxy-3-nitrobenzene is a versatile compound with potential applications in various chemical and pharmaceutical fields.
Formula:C8H7F2NO4
InChI:InChI=1S/C8H7F2NO4/c1-14-6-4-2-3-5(11(12)13)7(6)15-8(9)10/h2-4,8H,1H3
InChI key:InChIKey=SYGYZNHTUKHJPI-UHFFFAOYSA-N
SMILES:O(C(F)F)C1=C(N(=O)=O)C=CC=C1OC
Synonyms:
  • 2-(Difluoromethoxy)-1-methoxy-3-nitrobenzene
  • Benzene, 2-(difluoromethoxy)-1-methoxy-3-nitro-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.