CAS 1245773-11-8
:Ethyl 1-(difluoromethyl)-1H-pyrazole-5-carboxylate
Description:
Ethyl 1-(difluoromethyl)-1H-pyrazole-5-carboxylate is a chemical compound characterized by its unique structure, which includes a pyrazole ring substituted with a difluoromethyl group and an ethyl ester functional group. This compound typically exhibits properties associated with both pyrazole derivatives and carboxylates, such as moderate polarity and potential reactivity due to the presence of the carboxylate moiety. The difluoromethyl group can enhance lipophilicity and influence biological activity, making this compound of interest in medicinal chemistry and agrochemical applications. Ethyl 1-(difluoromethyl)-1H-pyrazole-5-carboxylate may also display interesting pharmacological properties, potentially acting as a scaffold for the development of new therapeutic agents. Its synthesis involves standard organic reactions, and it can be characterized using techniques such as NMR spectroscopy, mass spectrometry, and infrared spectroscopy. Safety and handling precautions should be observed, as with all chemical substances, to mitigate any risks associated with its use.
Formula:C7H8F2N2O2
InChI:InChI=1S/C7H8F2N2O2/c1-2-13-6(12)5-3-4-10-11(5)7(8)9/h3-4,7H,2H2,1H3
InChI key:InChIKey=KXGUFDQXUNGUDW-UHFFFAOYSA-N
SMILES:C(OCC)(=O)C=1N(C(F)F)N=CC1
Synonyms:- Ethyl 1-(difluoromethyl)-1H-pyrazole-5-carboxylate
- 1H-Pyrazole-5-carboxylic acid, 1-(difluoromethyl)-, ethyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
