CAS 1245773-18-5

Ethyl 5,5-difluoro-2,4-dioxopentanoate

Description:

Ethyl 5,5-difluoro-2,4-dioxopentanoate is an organic compound characterized by its unique structure, which includes a pentanoate backbone with two fluorine atoms attached to the fifth carbon and two carbonyl (dioxo) groups at the second and fourth positions. This compound is typically a colorless to pale yellow liquid or solid, depending on its purity and temperature. It is soluble in organic solvents, which makes it useful in various chemical reactions and applications. The presence of fluorine atoms often imparts unique properties, such as increased lipophilicity and altered reactivity, making it of interest in medicinal chemistry and agrochemical development. Ethyl 5,5-difluoro-2,4-dioxopentanoate may also exhibit interesting biological activities, although specific studies on its pharmacological effects may be limited. As with many fluorinated compounds, it is essential to handle it with care due to potential toxicity and environmental concerns. Proper safety measures should be observed when working with this substance in a laboratory setting.

Formula: C₇H₈F₂O₄

InChI: InChI=1S/C7H8F2O4/c1-2-13-7(12)5(11)3-4(10)6(8)9/h6H,2-3H2,1H3

InChI key: InChIKey=UVYGMVRFNMUGAX-UHFFFAOYSA-N

SMILES: C(CC(C(F)F)=O)(C(OCC)=O)=O

Synonyms:

• Pentanoic acid, 5,5-difluoro-2,4-dioxo-, ethyl ester
• Ethyl 5,5-difluoro-2,4-dioxopentanoate