CymitQuimica logo

CAS 1245773-20-9

:

1-Propyl-1H-pyrazole-3-carbonitrile

Description:
1-Propyl-1H-pyrazole-3-carbonitrile is a chemical compound characterized by its pyrazole ring structure, which is a five-membered ring containing two adjacent nitrogen atoms. This compound features a propyl group attached to the nitrogen atom at position one of the pyrazole ring and a cyano group (-C≡N) at position three. The presence of the cyano group contributes to its reactivity and potential applications in various chemical reactions. Typically, compounds like this may exhibit properties such as moderate to high polarity due to the electronegative nitrogen and cyano groups, influencing their solubility in polar solvents. Additionally, the structure suggests potential biological activity, making it of interest in pharmaceutical research. The compound's stability and reactivity can be influenced by the substituents on the pyrazole ring, which can affect its interaction with other molecules. Overall, 1-Propyl-1H-pyrazole-3-carbonitrile is a versatile compound with potential applications in medicinal chemistry and agrochemicals.
Formula:C7H9N3
InChI:InChI=1S/C7H9N3/c1-2-4-10-5-3-7(6-8)9-10/h3,5H,2,4H2,1H3
InChI key:InChIKey=HINNDJNBHMRFGL-UHFFFAOYSA-N
SMILES:C(CC)N1N=C(C#N)C=C1
Synonyms:
  • 1-Propyl-1H-pyrazole-3-carbonitrile
  • 1H-Pyrazole-3-carbonitrile, 1-propyl-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.