CAS 1245782-72-2

[1,2,3]Triazolo[1,5-a]pyrazine, 4,5,6,7-tetrahydro-3-phenyl-, hydrochloride (1:1)

Description:

[1,2,3]Triazolo[1,5-a]pyrazine, 4,5,6,7-tetrahydro-3-phenyl-, hydrochloride (1:1) is a chemical compound characterized by its unique bicyclic structure, which incorporates both triazole and pyrazine moieties. This compound typically exhibits properties associated with heterocyclic compounds, including potential biological activity due to its structural features. The presence of the tetrahydro group suggests that it is a saturated derivative, which may influence its solubility and reactivity. As a hydrochloride salt, it is likely to be more soluble in water compared to its free base form, enhancing its utility in pharmaceutical applications. The phenyl group contributes to its lipophilicity, potentially affecting its interaction with biological targets. This compound may be of interest in medicinal chemistry for its potential therapeutic effects, although specific biological activities would need to be investigated through empirical studies. Overall, its unique structure and properties make it a candidate for further research in drug development and related fields.

Formula: C₁₁H₁₂N₄·ClH

InChI: InChI=1S/C11H12N4.ClH/c1-2-4-9(5-3-1)11-10-8-12-6-7-15(10)14-13-11;/h1-5,12H,6-8H2;1H

InChI key: InChIKey=VIPHMUACPHIUCP-UHFFFAOYSA-N

SMILES: C1(=C2N(N=N1)CCNC2)C3=CC=CC=C3.Cl

Synonyms:

• [1,2,3]Triazolo[1,5-a]pyrazine, 4,5,6,7-tetrahydro-3-phenyl-, hydrochloride (1:1)

3-Phenyl-4,5,6,7-tetrahydro-1,2,3-triazolo[1,5-a]pyrazine, HCl

CAS: 1245782-72-2

Formula: C₁₁H₁₃ClN₄

Purity: 95%

Molecular weight: 236.7007

Ref: IN-DA000MEJ