CAS 1245782-76-6

1-(1,3-Dimethyl-1H-pyrazol-4-yl)-2,2-difluoroethanone oxime

Description:

1-(1,3-Dimethyl-1H-pyrazol-4-yl)-2,2-difluoroethanone oxime, with the CAS number 1245782-76-6, is a chemical compound characterized by its unique structural features, including a pyrazole ring and a difluoroethanone moiety. This compound typically exhibits properties associated with both its pyrazole and oxime functionalities, such as potential biological activity and reactivity. The presence of the difluoro group suggests enhanced lipophilicity and may influence its interaction with biological targets. The oxime functional group can participate in various chemical reactions, including condensation and nucleophilic substitution. Additionally, the compound may display specific solubility characteristics, depending on the solvent used, and could be sensitive to changes in pH or temperature. Its potential applications may span across fields such as pharmaceuticals, agrochemicals, or materials science, where its unique properties can be harnessed for specific purposes. Overall, this compound represents a fascinating example of modern synthetic chemistry with potential implications in various research areas.

Formula: C₇H₉F₂N₃O

InChI: InChI=1S/C7H9F2N3O/c1-4-5(3-12(2)10-4)6(11-13)7(8)9/h3,7,13H,1-2H3

InChI key: InChIKey=DIIWCRIQJXTOEN-UHFFFAOYSA-N

SMILES: C(C(F)F)(=NO)C1=CN(C)N=C1C

Synonyms:

• 1-(1,3-Dimethyl-1H-pyrazol-4-yl)-2,2-difluoroethanone oxime
• Ethanone, 1-(1,3-dimethyl-1H-pyrazol-4-yl)-2,2-difluoro-, oxime