CAS 1245782-77-7
:4-(2,2-Difluoroethoxy)benzaldehyde oxime
Description:
4-(2,2-Difluoroethoxy)benzaldehyde oxime is an organic compound characterized by the presence of a benzaldehyde moiety substituted with an oxime functional group and a difluoroethoxy side chain. The oxime group, derived from the reaction of an aldehyde with hydroxylamine, imparts specific reactivity, particularly in forming derivatives through condensation reactions. The difluoroethoxy group introduces significant electronegativity due to the presence of fluorine atoms, which can influence the compound's polarity, solubility, and overall reactivity. This compound may exhibit unique properties such as potential biological activity or utility in synthetic chemistry, particularly in the development of pharmaceuticals or agrochemicals. Its structure suggests that it could participate in various chemical reactions, including nucleophilic additions or substitutions, and may serve as a precursor for more complex molecules. Additionally, the presence of fluorine atoms often enhances metabolic stability and lipophilicity, making such compounds of interest in medicinal chemistry. Overall, 4-(2,2-Difluoroethoxy)benzaldehyde oxime represents a versatile building block in organic synthesis.
Formula:C9H9F2NO2
InChI:InChI=1S/C9H9F2NO2/c10-9(11)6-14-8-3-1-7(2-4-8)5-12-13/h1-5,9,13H,6H2
InChI key:InChIKey=LXDPMBJVLKKZER-UHFFFAOYSA-N
SMILES:O(CC(F)F)C1=CC=C(C=NO)C=C1
Synonyms:- Benzaldehyde, 4-(2,2-difluoroethoxy)-, oxime
- 4-(2,2-Difluoroethoxy)benzaldehyde oxime
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.