CymitQuimica logo

CAS 1245806-71-6

:

5-[(2-Methyl-1-piperidinyl)methyl]-2-thiophenecarboxylic acid

Description:
5-[(2-Methyl-1-piperidinyl)methyl]-2-thiophenecarboxylic acid, identified by its CAS number 1245806-71-6, is a chemical compound characterized by its unique structure that includes a thiophene ring and a piperidine moiety. This compound features a carboxylic acid functional group, which contributes to its acidic properties and potential for forming salts or esters. The presence of the piperidine ring suggests that it may exhibit basic characteristics, allowing it to participate in various chemical reactions, including nucleophilic substitutions. The methyl group on the piperidine enhances its lipophilicity, potentially influencing its solubility and biological activity. This compound may be of interest in medicinal chemistry due to its structural features, which could interact with biological targets. Additionally, its thiophene component may contribute to electronic properties that are relevant in organic electronics or photonic applications. Overall, the combination of these functional groups makes it a versatile compound for further research and development in various chemical and pharmaceutical contexts.
Formula:C12H17NO2S
InChI:InChI=1S/C12H17NO2S/c1-9-4-2-3-7-13(9)8-10-5-6-11(16-10)12(14)15/h5-6,9H,2-4,7-8H2,1H3,(H,14,15)
InChI key:InChIKey=HOPDZUOXNPWGEI-UHFFFAOYSA-N
SMILES:C(C=1SC(C(O)=O)=CC1)N2C(C)CCCC2
Synonyms:
  • 5-[(2-Methyl-1-piperidinyl)methyl]-2-thiophenecarboxylic acid
  • 2-Thiophenecarboxylic acid, 5-[(2-methyl-1-piperidinyl)methyl]-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.