CymitQuimica logo

CAS 1245807-11-7

:

N-(2,2-Difluoroethyl)-α,1-dimethyl-1H-pyrazole-3-methanamine

Description:
N-(2,2-Difluoroethyl)-α,1-dimethyl-1H-pyrazole-3-methanamine is a chemical compound characterized by its unique structure, which includes a pyrazole ring and a difluoroethyl substituent. The presence of the difluoroethyl group imparts specific electronic and steric properties, making it of interest in various chemical applications, particularly in medicinal chemistry and agrochemicals. The compound features a dimethyl substitution at the α position of the pyrazole, which can influence its reactivity and interaction with biological targets. As a methanamine derivative, it may exhibit basic properties due to the amine functional group, allowing for potential interactions with acids and other electrophiles. The compound's molecular structure suggests potential applications in drug development, where modifications to the pyrazole ring can lead to enhanced biological activity. Additionally, the fluorine atoms can enhance lipophilicity and metabolic stability, making this compound a candidate for further research in pharmacology and related fields.
Formula:C8H13F2N3
InChI:InChI=1S/C8H13F2N3/c1-6(11-5-8(9)10)7-3-4-13(2)12-7/h3-4,6,8,11H,5H2,1-2H3
InChI key:InChIKey=YFOPOAQPULRYGU-UHFFFAOYSA-N
SMILES:C(NCC(F)F)(C)C1=NN(C)C=C1
Synonyms:
  • N-(2,2-Difluoroethyl)-α,1-dimethyl-1H-pyrazole-3-methanamine
  • 1H-Pyrazole-3-methanamine, N-(2,2-difluoroethyl)-α,1-dimethyl-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.