CymitQuimica logo

CAS 1245807-17-3

:

N-Acetyl-N-cyclohexylglycine

Description:
N-Acetyl-N-cyclohexylglycine is an organic compound characterized by its structure, which includes an acetyl group and a cyclohexyl group attached to a glycine backbone. This compound is classified as an amino acid derivative, and its molecular structure contributes to its unique properties. It is typically a white to off-white solid, soluble in polar solvents, and may exhibit moderate stability under standard conditions. The presence of the acetyl group enhances its lipophilicity, while the cyclohexyl moiety can influence its steric and electronic properties. N-Acetyl-N-cyclohexylglycine may have applications in pharmaceuticals or as a biochemical probe due to its potential interactions with biological systems. Additionally, its synthesis involves standard organic reactions, making it accessible for research purposes. As with many chemical substances, safety data should be consulted to understand its handling and potential hazards. Overall, N-Acetyl-N-cyclohexylglycine represents a versatile compound with interesting chemical behavior and potential applications in various fields.
Formula:C10H17NO3
InChI:InChI=1S/C10H17NO3/c1-8(12)11(7-10(13)14)9-5-3-2-4-6-9/h9H,2-7H2,1H3,(H,13,14)
InChI key:InChIKey=HWCZNXXRUZTNNE-UHFFFAOYSA-N
SMILES:N(CC(O)=O)(C(C)=O)C1CCCCC1
Synonyms:
  • N-Acetyl-N-cyclohexylglycine
  • Glycine, N-acetyl-N-cyclohexyl-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.