CAS 1245807-31-1

4-Chloro-1-methyl-1H-pyrazole-5-sulfonyl chloride

Description:

4-Chloro-1-methyl-1H-pyrazole-5-sulfonyl chloride is a chemical compound characterized by its pyrazole ring structure, which is a five-membered ring containing two nitrogen atoms. The presence of a sulfonyl chloride group (-SO2Cl) indicates that it is a sulfonyl chloride derivative, making it a reactive compound often used in organic synthesis. The chlorine substituent at the 4-position and the methyl group at the 1-position of the pyrazole ring contribute to its unique reactivity and potential applications in medicinal chemistry and agrochemicals. This compound is typically a solid at room temperature and may be sensitive to moisture, requiring careful handling and storage conditions. Its reactivity allows it to participate in various chemical reactions, including nucleophilic substitutions and coupling reactions, making it valuable in the synthesis of more complex molecules. As with many sulfonyl chlorides, it is important to handle this compound with caution due to its potential to release hydrochloric acid upon reaction with water or alcohols.

Formula: C₄H₄Cl₂N₂O₂S

InChI: InChI=1S/C4H4Cl2N2O2S/c1-8-4(11(6,9)10)3(5)2-7-8/h2H,1H3

InChI key: InChIKey=QAISCMHOYPFPLT-UHFFFAOYSA-N

SMILES: S(Cl)(=O)(=O)C1=C(Cl)C=NN1C

Synonyms:

• 1H-Pyrazole-5-sulfonyl chloride, 4-chloro-1-methyl-
• 4-Chloro-1-methyl-1H-pyrazole-5-sulfonyl chloride

4-Chloro-1-methyl-1H-pyrazole-5-sulfonyl chloride

CAS: 1245807-31-1

Versatile small molecule scaffold

Formula: C₄H₄Cl₂N₂O₂S

Purity: Min. 95%

Molecular weight: 215.06 g/mol

Ref: 3D-VZB80731