CymitQuimica logo

CAS 1245807-33-3

:

4-Chloro-3-methyl-1-(1-methylethyl)-1H-pyrazole-5-sulfonyl chloride

Description:
4-Chloro-3-methyl-1-(1-methylethyl)-1H-pyrazole-5-sulfonyl chloride is a chemical compound characterized by its pyrazole ring structure, which is a five-membered heterocyclic compound containing two nitrogen atoms. This substance features a sulfonyl chloride functional group, making it a reactive compound often used in organic synthesis. The presence of the chloro and methyl groups on the pyrazole ring contributes to its unique reactivity and potential applications in medicinal chemistry and agrochemicals. The sulfonyl chloride moiety is particularly significant as it can participate in nucleophilic substitution reactions, allowing for the introduction of various nucleophiles. This compound is typically handled with care due to its reactivity and potential hazards associated with sulfonyl chlorides, including the release of hydrochloric acid upon hydrolysis. Its applications may extend to the development of pharmaceuticals or as an intermediate in the synthesis of other complex organic molecules. As with all chemical substances, proper safety protocols should be followed when handling this compound.
Formula:C7H10Cl2N2O2S
InChI:InChI=1S/C7H10Cl2N2O2S/c1-4(2)11-7(14(9,12)13)6(8)5(3)10-11/h4H,1-3H3
InChI key:InChIKey=SJJRGEHWYPPOIZ-UHFFFAOYSA-N
SMILES:S(Cl)(=O)(=O)C=1N(C(C)C)N=C(C)C1Cl
Synonyms:
  • 4-Chloro-3-methyl-1-(1-methylethyl)-1H-pyrazole-5-sulfonyl chloride
  • 1H-Pyrazole-5-sulfonyl chloride, 4-chloro-3-methyl-1-(1-methylethyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.