CAS 1245807-34-4

3-Methyl-1-propyl-1H-pyrazole-5-sulfonyl chloride

Description:

3-Methyl-1-propyl-1H-pyrazole-5-sulfonyl chloride is a chemical compound characterized by its sulfonyl chloride functional group, which is known for its reactivity and ability to form sulfonamides. This compound features a pyrazole ring, a five-membered aromatic heterocycle containing two nitrogen atoms, contributing to its unique chemical properties. The presence of the methyl and propyl groups enhances its hydrophobic characteristics, influencing its solubility and interaction with other molecules. As a sulfonyl chloride, it is typically used as a reagent in organic synthesis, particularly in the formation of sulfonamides and other derivatives. The compound is likely to be sensitive to moisture and should be handled with care, as it can release hydrochloric acid upon hydrolysis. Its applications may extend to pharmaceuticals and agrochemicals, where it can serve as an intermediate in the synthesis of biologically active compounds. Proper safety measures should be observed when working with this substance due to its potential hazards.

Formula: C₇H₁₁ClN₂O₂S

InChI: InChI=1S/C7H11ClN2O2S/c1-3-4-10-7(13(8,11)12)5-6(2)9-10/h5H,3-4H2,1-2H3

InChI key: InChIKey=RQDUUPGOARPRBB-UHFFFAOYSA-N

SMILES: S(Cl)(=O)(=O)C=1N(CCC)N=C(C)C1

Synonyms:

• 1H-Pyrazole-5-sulfonyl chloride, 3-methyl-1-propyl-
• 3-Methyl-1-propyl-1H-pyrazole-5-sulfonyl chloride

3-Methyl-1-propyl-1H-pyrazole-5-sulfonyl chloride

CAS: 1245807-34-4

Versatile small molecule scaffold

Formula: C₇H₁₁ClN₂O₂S

Purity: Min. 95%

Molecular weight: 222.69 g/mol

Ref: 3D-VZB80734