CAS 1245807-66-2

5-Methyl-1H-pyrazolo[3,4-b]pyridine-1-propanoic acid

Description:

5-Methyl-1H-pyrazolo[3,4-b]pyridine-1-propanoic acid is a heterocyclic organic compound characterized by its unique pyrazolo-pyridine structure, which incorporates both a pyrazole and a pyridine ring. This compound features a methyl group at the 5-position of the pyrazole ring and a propanoic acid functional group, contributing to its potential biological activity. It is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the presence of the carboxylic acid group. The compound is of interest in medicinal chemistry, particularly for its potential applications in drug development, as derivatives of pyrazolo-pyridine structures have been associated with various pharmacological activities. Its molecular interactions, stability, and reactivity can be influenced by the presence of the methyl and propanoic acid substituents, making it a subject of study in both synthetic and medicinal chemistry. As with many organic compounds, proper handling and safety measures should be observed due to potential toxicity or reactivity.

Formula: C₁₀H₁₁N₃O₂

InChI: InChI=1S/C10H11N3O2/c1-7-4-8-6-12-13(3-2-9(14)15)10(8)11-5-7/h4-6H,2-3H2,1H3,(H,14,15)

InChI key: InChIKey=OXVMQOBRSXKDJI-UHFFFAOYSA-N

SMILES: C(CC(O)=O)N1C=2C(C=N1)=CC(C)=CN2

Synonyms:

• 5-Methyl-1H-pyrazolo[3,4-b]pyridine-1-propanoic acid
• 1H-Pyrazolo[3,4-b]pyridine-1-propanoic acid, 5-methyl-

3-{5-Methyl-1H-pyrazolo[3,4-b]pyridin-1-yl}propanoic acid

CAS: 1245807-66-2

Versatile small molecule scaffold

Formula: C₁₀H₁₁N₃O₂

Purity: Min. 95%

Molecular weight: 205.21 g/mol

Ref: 3D-VZB80766