CAS 1245807-75-3

Ethyl 1-[(4-chlorophenyl)methyl]-6,7-dihydro-6-oxo-1H-pyrazolo[3,4-b]pyridine-4-carboxylate

Description:

Ethyl 1-[(4-chlorophenyl)methyl]-6,7-dihydro-6-oxo-1H-pyrazolo[3,4-b]pyridine-4-carboxylate is a chemical compound characterized by its complex structure, which includes a pyrazolo-pyridine core. This compound features a carboxylate ester functional group, contributing to its potential reactivity and solubility properties. The presence of a 4-chlorophenyl group indicates that it may exhibit specific biological activities, possibly related to its interaction with various biological targets. The dihydro and oxo groups suggest that it may participate in various chemical reactions, including nucleophilic attacks or redox processes. Its molecular structure implies potential applications in medicinal chemistry, particularly in the development of pharmaceuticals. The compound's characteristics, such as melting point, boiling point, solubility, and stability, would depend on its specific interactions with solvents and other chemical entities. Overall, this compound represents a class of heterocyclic compounds that may possess interesting pharmacological properties, warranting further investigation in drug discovery and development.

Formula: C₁₆H₁₄ClN₃O₃

InChI: InChI=1S/C16H14ClN3O3/c1-2-23-16(22)12-7-14(21)19-15-13(12)8-18-20(15)9-10-3-5-11(17)6-4-10/h3-8H,2,9H2,1H3,(H,19,21)

InChI key: InChIKey=BHLRNZIVBALESL-UHFFFAOYSA-N

SMILES: C(OCC)(=O)C=1C2=C(N(CC3=CC=C(Cl)C=C3)N=C2)NC(=O)C1

Synonyms:

• Ethyl 1-[(4-chlorophenyl)methyl]-6,7-dihydro-6-oxo-1H-pyrazolo[3,4-b]pyridine-4-carboxylate
• 1H-Pyrazolo[3,4-b]pyridine-4-carboxylic acid, 1-[(4-chlorophenyl)methyl]-6,7-dihydro-6-oxo-, ethyl ester