CAS 1245807-85-5

5-Methyl-2H-pyrazolo[3,4-b]pyridine-2-propanoic acid

Description:

5-Methyl-2H-pyrazolo[3,4-b]pyridine-2-propanoic acid is a heterocyclic organic compound characterized by its pyrazolo-pyridine structure, which incorporates both a pyrazole and a pyridine ring. This compound features a methyl group at the 5-position of the pyrazole ring and a propanoic acid functional group, contributing to its acidic properties. The presence of these functional groups suggests potential biological activity, making it of interest in medicinal chemistry and drug development. The compound's molecular structure allows for various interactions, including hydrogen bonding and pi-stacking, which can influence its solubility and reactivity. Additionally, the specific arrangement of atoms and functional groups may impart unique pharmacological properties, potentially affecting its efficacy and safety profile in biological systems. As with many heterocycles, the compound may exhibit interesting electronic properties due to the conjugation between the nitrogen atoms and the aromatic systems, which can be relevant in the design of new materials or pharmaceuticals.

Formula: C₁₀H₁₁N₃O₂

InChI: InChI=1S/C10H11N3O2/c1-7-4-8-6-13(3-2-9(14)15)12-10(8)11-5-7/h4-6H,2-3H2,1H3,(H,14,15)

InChI key: InChIKey=SNBGDEQZDNBIGF-UHFFFAOYSA-N

SMILES: C(CC(O)=O)N1N=C2C(=C1)C=C(C)C=N2

Synonyms:

• 2H-Pyrazolo[3,4-b]pyridine-2-propanoic acid, 5-methyl-
• 5-Methyl-2H-pyrazolo[3,4-b]pyridine-2-propanoic acid

3-{5-Methyl-2H-pyrazolo[3,4-b]pyridin-2-yl}propanoic acid

CAS: 1245807-85-5

Versatile small molecule scaffold

Formula: C₁₀H₁₁N₃O₂

Purity: Min. 95%

Molecular weight: 205.21 g/mol

Ref: 3D-VZB80785