CAS 1245807-86-6

Ethyl 7-(trifluoromethyl)pyrazolo[1,5-a]pyrimidine-6-carboxylate

Description:

Ethyl 7-(trifluoromethyl)pyrazolo[1,5-a]pyrimidine-6-carboxylate is a chemical compound characterized by its unique pyrazolo-pyrimidine structure, which incorporates a trifluoromethyl group at the 7-position. This compound features an ethyl ester functional group, contributing to its solubility and reactivity. The presence of the trifluoromethyl group enhances its lipophilicity and can influence biological activity, making it of interest in medicinal chemistry. The pyrazolo[1,5-a]pyrimidine framework is known for its potential pharmacological properties, including anti-inflammatory and anti-cancer activities. The compound's molecular structure suggests it may participate in various chemical reactions, including nucleophilic substitutions and esterifications. Its CAS number, 1245807-86-6, allows for easy identification in chemical databases. Overall, this compound represents a class of heterocyclic compounds that are valuable in drug discovery and development due to their diverse biological activities and potential therapeutic applications.

Formula: C₁₀H₈F₃N₃O₂

InChI: InChI=1S/C10H8F3N3O2/c1-2-18-9(17)6-5-14-7-3-4-15-16(7)8(6)10(11,12)13/h3-5H,2H2,1H3

InChI key: InChIKey=FFEIMXUSQRNSGZ-UHFFFAOYSA-N

SMILES: C(F)(F)(F)C=1N2C(N=CC1C(OCC)=O)=CC=N2

Synonyms:

• Ethyl 7-(trifluoromethyl)pyrazolo[1,5-a]pyrimidine-6-carboxylate
• Pyrazolo[1,5-a]pyrimidine-6-carboxylic acid, 7-(trifluoromethyl)-, ethyl ester