CymitQuimica logo

CAS 1245807-90-2

:

1-Ethyl-4-iodo-3,5-dimethyl-1H-pyrazole

Description:
1-Ethyl-4-iodo-3,5-dimethyl-1H-pyrazole is an organic compound characterized by its pyrazole ring structure, which is a five-membered ring containing two nitrogen atoms. This compound features an ethyl group at the 1-position, an iodine atom at the 4-position, and two methyl groups at the 3 and 5 positions of the pyrazole ring. The presence of the iodine atom introduces notable reactivity, making it a potential candidate for various chemical transformations, including nucleophilic substitutions. The methyl groups contribute to the compound's hydrophobic character, influencing its solubility and interaction with biological systems. Additionally, the ethyl group enhances the steric bulk around the nitrogen atoms, which can affect the compound's reactivity and stability. This compound may have applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the presence of the pyrazole moiety, which is often associated with various biological activities. Overall, 1-Ethyl-4-iodo-3,5-dimethyl-1H-pyrazole is a structurally interesting compound with potential utility in synthetic and medicinal chemistry.
Formula:C7H11IN2
InChI:InChI=1S/C7H11IN2/c1-4-10-6(3)7(8)5(2)9-10/h4H2,1-3H3
InChI key:InChIKey=LCEVIOMNOSQCQS-UHFFFAOYSA-N
SMILES:C(C)N1C(C)=C(I)C(C)=N1
Synonyms:
  • 1H-Pyrazole, 1-ethyl-4-iodo-3,5-dimethyl-
  • 1-Ethyl-4-iodo-3,5-dimethylpyrazole
  • 1-Ethyl-4-iodo-3,5-dimethyl-1H-pyrazole
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.